C13H19BrClNO2 — CID 171254231
2-[(S)-amino(cyclopentyl)methyl]-3-bromo-6-methoxyphenol;hydrochloride (PubChem CID 171254231) has the molecular formula C13H19BrClNO2 and a molecular weight of 336.66 g/mol. Its IUPAC name is 2-[(S)-amino(cyclopentyl)methyl]-3-bromo-6-methoxyphenol;hydrochloride.
| Compound Name | 2-[(S)-amino(cyclopentyl)methyl]-3-bromo-6-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171254231 |
| Molecular Formula | C13H19BrClNO2 |
| Molecular Weight | 336.66 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 2-[(S)-amino(cyclopentyl)methyl]-3-bromo-6-methoxyphenol;hydrochloride |
| SMILES | COc1ccc(Br)c([C@@H](N)C2CCCC2)c1O.Cl |
| InChI | InChI=1S/C13H18BrNO2.ClH/c1-17-10-7-6-9(14)11(13(10)16)12(15)8-4-2-3-5-8;/h6-8,12,16H,2-5,15H2,1H3;1H/t12-;/m0./s1 |
| InChIKey | ITGTYUDETCAABX-YDALLXLXSA-N |
| XLogP | 3.78 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.66 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|