C12H16Br2ClNO2 — CID 171256660
2-[(R)-amino(oxan-4-yl)methyl]-3,6-dibromophenol;hydrochloride (PubChem CID 171256660) has the molecular formula C12H16Br2ClNO2 and a molecular weight of 401.53 g/mol. Its IUPAC name is 2-[(R)-amino(oxan-4-yl)methyl]-3,6-dibromophenol;hydrochloride.
| Compound Name | 2-[(R)-amino(oxan-4-yl)methyl]-3,6-dibromophenol;hydrochloride |
|---|---|
| PubChem CID | 171256660 |
| Molecular Formula | C12H16Br2ClNO2 |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 398.92 |
| IUPAC Name | 2-[(R)-amino(oxan-4-yl)methyl]-3,6-dibromophenol;hydrochloride |
| SMILES | Cl.N[C@@H](c1c(Br)ccc(Br)c1O)C1CCOCC1 |
| InChI | InChI=1S/C12H15Br2NO2.ClH/c13-8-1-2-9(14)12(16)10(8)11(15)7-3-5-17-6-4-7;/h1-2,7,11,16H,3-6,15H2;1H/t11-;/m1./s1 |
| InChIKey | GNZNEBUVXSTITA-RFVHGSKJSA-N |
| XLogP | 3.77 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|