C13H18BrNO3 — CID 171257580
2-[(R)-amino(oxan-4-yl)methyl]-3-bromo-6-methoxyphenol (PubChem CID 171257580) has the molecular formula C13H18BrNO3 and a molecular weight of 316.19 g/mol. Its IUPAC name is 2-[(R)-amino(oxan-4-yl)methyl]-3-bromo-6-methoxyphenol.
| Compound Name | 2-[(R)-amino(oxan-4-yl)methyl]-3-bromo-6-methoxyphenol |
|---|---|
| PubChem CID | 171257580 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 2-[(R)-amino(oxan-4-yl)methyl]-3-bromo-6-methoxyphenol |
| SMILES | COc1ccc(Br)c([C@H](N)C2CCOCC2)c1O |
| InChI | InChI=1S/C13H18BrNO3/c1-17-10-3-2-9(14)11(13(10)16)12(15)8-4-6-18-7-5-8/h2-3,8,12,16H,4-7,15H2,1H3/t12-/m1/s1 |
| InChIKey | XZNRHAXIKRAWBB-GFCCVEGCSA-N |
| XLogP | 2.59 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|