C9H10BrF2NO2 — CID 131561211
2-[(1R)-1-amino-2,2-difluoroethyl]-3-bromo-6-methoxyphenol (PubChem CID 131561211) has the molecular formula C9H10BrF2NO2 and a molecular weight of 282.08 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2-difluoroethyl]-3-bromo-6-methoxyphenol.
| Compound Name | 2-[(1R)-1-amino-2,2-difluoroethyl]-3-bromo-6-methoxyphenol |
|---|---|
| PubChem CID | 131561211 |
| Molecular Formula | C9H10BrF2NO2 |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | 2-[(1R)-1-amino-2,2-difluoroethyl]-3-bromo-6-methoxyphenol |
| SMILES | COc1ccc(Br)c([C@@H](N)C(F)F)c1O |
| InChI | InChI=1S/C9H10BrF2NO2/c1-15-5-3-2-4(10)6(8(5)14)7(13)9(11)12/h2-3,7,9,14H,13H2,1H3/t7-/m1/s1 |
| InChIKey | PXGHJAGFVBUUSA-SSDOTTSWSA-N |
| XLogP | 2.43 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|