C12H15Br2NO — CID 131500799
2-[(S)-amino(cyclopentyl)methyl]-3,6-dibromophenol (PubChem CID 131500799) has the molecular formula C12H15Br2NO and a molecular weight of 349.07 g/mol. Its IUPAC name is 2-[(S)-amino(cyclopentyl)methyl]-3,6-dibromophenol.
| Compound Name | 2-[(S)-amino(cyclopentyl)methyl]-3,6-dibromophenol |
|---|---|
| PubChem CID | 131500799 |
| Molecular Formula | C12H15Br2NO |
| Molecular Weight | 349.07 g/mol |
| Exact Mass | 346.95 |
| IUPAC Name | 2-[(S)-amino(cyclopentyl)methyl]-3,6-dibromophenol |
| SMILES | N[C@H](c1c(Br)ccc(Br)c1O)C1CCCC1 |
| InChI | InChI=1S/C12H15Br2NO/c13-8-5-6-9(14)12(16)10(8)11(15)7-3-1-2-4-7/h5-7,11,16H,1-4,15H2/t11-/m0/s1 |
| InChIKey | PMVKOKSKTRLQQL-NSHDSACASA-N |
| XLogP | 4.11 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.07 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|