C13H15BrN2O — CID 171257889
3-[(R)-amino(cyclopentyl)methyl]-4-bromo-2-hydroxybenzonitrile (PubChem CID 171257889) has the molecular formula C13H15BrN2O and a molecular weight of 295.18 g/mol. Its IUPAC name is 3-[(R)-amino(cyclopentyl)methyl]-4-bromo-2-hydroxybenzonitrile.
| Compound Name | 3-[(R)-amino(cyclopentyl)methyl]-4-bromo-2-hydroxybenzonitrile |
|---|---|
| PubChem CID | 171257889 |
| Molecular Formula | C13H15BrN2O |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 3-[(R)-amino(cyclopentyl)methyl]-4-bromo-2-hydroxybenzonitrile |
| SMILES | N#Cc1ccc(Br)c([C@H](N)C2CCCC2)c1O |
| InChI | InChI=1S/C13H15BrN2O/c14-10-6-5-9(7-15)13(17)11(10)12(16)8-3-1-2-4-8/h5-6,8,12,17H,1-4,16H2/t12-/m1/s1 |
| InChIKey | SROAGNGCKVMCRE-GFCCVEGCSA-N |
| XLogP | 3.22 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|