C9H7BrClF3N2O — CID 171254539
3-[(1R)-1-amino-2,2,2-trifluoroethyl]-4-bromo-2-hydroxybenzonitrile;hydrochloride (PubChem CID 171254539) has the molecular formula C9H7BrClF3N2O and a molecular weight of 331.52 g/mol. Its IUPAC name is 3-[(1R)-1-amino-2,2,2-trifluoroethyl]-4-bromo-2-hydroxybenzonitrile;hydrochloride.
| Compound Name | 3-[(1R)-1-amino-2,2,2-trifluoroethyl]-4-bromo-2-hydroxybenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 171254539 |
| Molecular Formula | C9H7BrClF3N2O |
| Molecular Weight | 331.52 g/mol |
| Exact Mass | 329.94 |
| IUPAC Name | 3-[(1R)-1-amino-2,2,2-trifluoroethyl]-4-bromo-2-hydroxybenzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1ccc(Br)c([C@@H](N)C(F)(F)F)c1O |
| InChI | InChI=1S/C9H6BrF3N2O.ClH/c10-5-2-1-4(3-14)7(16)6(5)8(15)9(11,12)13;/h1-2,8,16H,15H2;1H/t8-;/m1./s1 |
| InChIKey | NJLHGNMDRDWZBB-DDWIOCJRSA-N |
| XLogP | 3.01 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|