C9H6F3N3O3 — CID 66511895
3-[(1R)-1-amino-2,2,2-trifluoroethyl]-2-hydroxy-4-nitrobenzonitrile (PubChem CID 66511895) has the molecular formula C9H6F3N3O3 and a molecular weight of 261.16 g/mol. Its IUPAC name is 3-[(1R)-1-amino-2,2,2-trifluoroethyl]-2-hydroxy-4-nitrobenzonitrile.
| Compound Name | 3-[(1R)-1-amino-2,2,2-trifluoroethyl]-2-hydroxy-4-nitrobenzonitrile |
|---|---|
| PubChem CID | 66511895 |
| Molecular Formula | C9H6F3N3O3 |
| Molecular Weight | 261.16 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 3-[(1R)-1-amino-2,2,2-trifluoroethyl]-2-hydroxy-4-nitrobenzonitrile |
| SMILES | N#Cc1ccc([N+](=O)[O-])c([C@@H](N)C(F)(F)F)c1O |
| InChI | InChI=1S/C9H6F3N3O3/c10-9(11,12)8(14)6-5(15(17)18)2-1-4(3-13)7(6)16/h1-2,8,16H,14H2/t8-/m1/s1 |
| InChIKey | LTFKBDITZQQUAB-MRVPVSSYSA-N |
| XLogP | 1.73 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.16 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|