C12H11BrF2N2O3 — CID 171257880
ethyl (3S)-3-amino-3-(6-bromo-3-cyano-2-hydroxyphenyl)-2,2-difluoropropanoate (PubChem CID 171257880) has the molecular formula C12H11BrF2N2O3 and a molecular weight of 349.13 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(6-bromo-3-cyano-2-hydroxyphenyl)-2,2-difluoropropanoate.
| Compound Name | ethyl (3S)-3-amino-3-(6-bromo-3-cyano-2-hydroxyphenyl)-2,2-difluoropropanoate |
|---|---|
| PubChem CID | 171257880 |
| Molecular Formula | C12H11BrF2N2O3 |
| Molecular Weight | 349.13 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | ethyl (3S)-3-amino-3-(6-bromo-3-cyano-2-hydroxyphenyl)-2,2-difluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)[C@@H](N)c1c(Br)ccc(C#N)c1O |
| InChI | InChI=1S/C12H11BrF2N2O3/c1-2-20-11(19)12(14,15)10(17)8-7(13)4-3-6(5-16)9(8)18/h3-4,10,18H,2,17H2,1H3/t10-/m0/s1 |
| InChIKey | MSKMDRWEXHEDSX-JTQLQIEISA-N |
| XLogP | 2.22 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.13 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|