C9H9F3N2O2 — CID 66510237
(1S)-2,2,2-trifluoro-1-(4-methyl-2-nitrophenyl)ethanamine (PubChem CID 66510237) has the molecular formula C9H9F3N2O2 and a molecular weight of 234.18 g/mol. Its IUPAC name is (1S)-2,2,2-trifluoro-1-(4-methyl-2-nitrophenyl)ethanamine.
| Compound Name | (1S)-2,2,2-trifluoro-1-(4-methyl-2-nitrophenyl)ethanamine |
|---|---|
| PubChem CID | 66510237 |
| Molecular Formula | C9H9F3N2O2 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | (1S)-2,2,2-trifluoro-1-(4-methyl-2-nitrophenyl)ethanamine |
| SMILES | Cc1ccc([C@H](N)C(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H9F3N2O2/c1-5-2-3-6(7(4-5)14(15)16)8(13)9(10,11)12/h2-4,8H,13H2,1H3/t8-/m0/s1 |
| InChIKey | KRWDZPOACGNZSS-QMMMGPOBSA-N |
| XLogP | 2.47 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|