C8H6F4N2O2 — CID 66510268
(1S)-2,2,2-trifluoro-1-(5-fluoro-2-nitrophenyl)ethanamine (PubChem CID 66510268) has the molecular formula C8H6F4N2O2 and a molecular weight of 238.14 g/mol. Its IUPAC name is (1S)-2,2,2-trifluoro-1-(5-fluoro-2-nitrophenyl)ethanamine.
| Compound Name | (1S)-2,2,2-trifluoro-1-(5-fluoro-2-nitrophenyl)ethanamine |
|---|---|
| PubChem CID | 66510268 |
| Molecular Formula | C8H6F4N2O2 |
| Molecular Weight | 238.14 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | (1S)-2,2,2-trifluoro-1-(5-fluoro-2-nitrophenyl)ethanamine |
| SMILES | N[C@@H](c1cc(F)ccc1[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C8H6F4N2O2/c9-4-1-2-6(14(15)16)5(3-4)7(13)8(10,11)12/h1-3,7H,13H2/t7-/m0/s1 |
| InChIKey | NQJNOENGMXOVPT-ZETCQYMHSA-N |
| XLogP | 2.30 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.14 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|