C8H8ClF3N2O2 — CID 171248349
(1S)-2,2-difluoro-1-(5-fluoro-2-nitrophenyl)ethanamine;hydrochloride (PubChem CID 171248349) has the molecular formula C8H8ClF3N2O2 and a molecular weight of 256.61 g/mol. Its IUPAC name is (1S)-2,2-difluoro-1-(5-fluoro-2-nitrophenyl)ethanamine;hydrochloride.
| Compound Name | (1S)-2,2-difluoro-1-(5-fluoro-2-nitrophenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 171248349 |
| Molecular Formula | C8H8ClF3N2O2 |
| Molecular Weight | 256.61 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | (1S)-2,2-difluoro-1-(5-fluoro-2-nitrophenyl)ethanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1cc(F)ccc1[N+](=O)[O-])C(F)F |
| InChI | InChI=1S/C8H7F3N2O2.ClH/c9-4-1-2-6(13(14)15)5(3-4)7(12)8(10)11;/h1-3,7-8H,12H2;1H/t7-;/m0./s1 |
| InChIKey | SVEXLTWBKIKUOM-FJXQXJEOSA-N |
| XLogP | 2.42 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.61 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|