C9H10ClF3N2O2 — CID 171313687
(1R)-3,3-difluoro-1-(5-fluoro-2-nitrophenyl)propan-1-amine;hydrochloride (PubChem CID 171313687) has the molecular formula C9H10ClF3N2O2 and a molecular weight of 270.64 g/mol. Its IUPAC name is (1R)-3,3-difluoro-1-(5-fluoro-2-nitrophenyl)propan-1-amine;hydrochloride.
| Compound Name | (1R)-3,3-difluoro-1-(5-fluoro-2-nitrophenyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171313687 |
| Molecular Formula | C9H10ClF3N2O2 |
| Molecular Weight | 270.64 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | (1R)-3,3-difluoro-1-(5-fluoro-2-nitrophenyl)propan-1-amine;hydrochloride |
| SMILES | Cl.N[C@H](CC(F)F)c1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9F3N2O2.ClH/c10-5-1-2-8(14(15)16)6(3-5)7(13)4-9(11)12;/h1-3,7,9H,4,13H2;1H/t7-;/m1./s1 |
| InChIKey | JKOGRXINJYMFHG-OGFXRTJISA-N |
| XLogP | 2.81 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.64 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|