C15H16ClFN2O3 — CID 171262733
(1R,2S)-1-amino-1-(5-fluoro-2-nitrophenyl)-3-phenylpropan-2-ol;hydrochloride (PubChem CID 171262733) has the molecular formula C15H16ClFN2O3 and a molecular weight of 326.76 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(5-fluoro-2-nitrophenyl)-3-phenylpropan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-(5-fluoro-2-nitrophenyl)-3-phenylpropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171262733 |
| Molecular Formula | C15H16ClFN2O3 |
| Molecular Weight | 326.76 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | (1R,2S)-1-amino-1-(5-fluoro-2-nitrophenyl)-3-phenylpropan-2-ol;hydrochloride |
| SMILES | Cl.N[C@H](c1cc(F)ccc1[N+](=O)[O-])[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C15H15FN2O3.ClH/c16-11-6-7-13(18(20)21)12(9-11)15(17)14(19)8-10-4-2-1-3-5-10;/h1-7,9,14-15,19H,8,17H2;1H/t14-,15+;/m0./s1 |
| InChIKey | WJAPRERNXLOJMO-LDXVYITESA-N |
| XLogP | 2.76 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.76 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|