C17H21ClN2O5 — CID 171265053
(1R,2S)-1-amino-1-(4,5-dimethoxy-2-nitrophenyl)-3-phenylpropan-2-ol;hydrochloride (PubChem CID 171265053) has the molecular formula C17H21ClN2O5 and a molecular weight of 368.82 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(4,5-dimethoxy-2-nitrophenyl)-3-phenylpropan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-(4,5-dimethoxy-2-nitrophenyl)-3-phenylpropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171265053 |
| Molecular Formula | C17H21ClN2O5 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | (1R,2S)-1-amino-1-(4,5-dimethoxy-2-nitrophenyl)-3-phenylpropan-2-ol;hydrochloride |
| SMILES | COc1cc([C@@H](N)[C@@H](O)Cc2ccccc2)c([N+](=O)[O-])cc1OC.Cl |
| InChI | InChI=1S/C17H20N2O5.ClH/c1-23-15-9-12(13(19(21)22)10-16(15)24-2)17(18)14(20)8-11-6-4-3-5-7-11;/h3-7,9-10,14,17,20H,8,18H2,1-2H3;1H/t14-,17+;/m0./s1 |
| InChIKey | CKZNAEHSROHESI-SQQLFYIASA-N |
| XLogP | 2.64 |
| TPSA | 107.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|