C15H17ClN2O4 — CID 171261156
4-[(1R,2S)-1-amino-2-hydroxy-3-phenylpropyl]-2-nitrophenol;hydrochloride (PubChem CID 171261156) has the molecular formula C15H17ClN2O4 and a molecular weight of 324.76 g/mol. Its IUPAC name is 4-[(1R,2S)-1-amino-2-hydroxy-3-phenylpropyl]-2-nitrophenol;hydrochloride.
| Compound Name | 4-[(1R,2S)-1-amino-2-hydroxy-3-phenylpropyl]-2-nitrophenol;hydrochloride |
|---|---|
| PubChem CID | 171261156 |
| Molecular Formula | C15H17ClN2O4 |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 4-[(1R,2S)-1-amino-2-hydroxy-3-phenylpropyl]-2-nitrophenol;hydrochloride |
| SMILES | Cl.N[C@H](c1ccc(O)c([N+](=O)[O-])c1)[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C15H16N2O4.ClH/c16-15(14(19)8-10-4-2-1-3-5-10)11-6-7-13(18)12(9-11)17(20)21;/h1-7,9,14-15,18-19H,8,16H2;1H/t14-,15+;/m0./s1 |
| InChIKey | GDCIEWKEUXKNQR-LDXVYITESA-N |
| XLogP | 2.33 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|