C13H20N2O4 — CID 171261153
4-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]-2-nitrophenol (PubChem CID 171261153) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 4-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]-2-nitrophenol.
| Compound Name | 4-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]-2-nitrophenol |
|---|---|
| PubChem CID | 171261153 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 4-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]-2-nitrophenol |
| SMILES | CC(C)CC[C@H](O)[C@H](N)c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H20N2O4/c1-8(2)3-5-12(17)13(14)9-4-6-11(16)10(7-9)15(18)19/h4,6-8,12-13,16-17H,3,5,14H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | NHORASOKJALLPB-QWHCGFSZSA-N |
| XLogP | 2.10 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|