C13H20ClNO2 — CID 171261794
4-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]-2-chlorophenol (PubChem CID 171261794) has the molecular formula C13H20ClNO2 and a molecular weight of 257.76 g/mol. Its IUPAC name is 4-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]-2-chlorophenol.
| Compound Name | 4-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]-2-chlorophenol |
|---|---|
| PubChem CID | 171261794 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 4-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]-2-chlorophenol |
| SMILES | CC(C)CC[C@H](O)[C@H](N)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C13H20ClNO2/c1-8(2)3-5-12(17)13(15)9-4-6-11(16)10(14)7-9/h4,6-8,12-13,16-17H,3,5,15H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | OLYIRSDGRRAPCH-QWHCGFSZSA-N |
| XLogP | 2.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |