C16H27NO — CID 171261237
(1R,2S)-1-amino-5-methyl-1-(4-propan-2-ylphenyl)hexan-2-ol (PubChem CID 171261237) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (1R,2S)-1-amino-5-methyl-1-(4-propan-2-ylphenyl)hexan-2-ol.
| Compound Name | (1R,2S)-1-amino-5-methyl-1-(4-propan-2-ylphenyl)hexan-2-ol |
|---|---|
| PubChem CID | 171261237 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (1R,2S)-1-amino-5-methyl-1-(4-propan-2-ylphenyl)hexan-2-ol |
| SMILES | CC(C)CC[C@H](O)[C@H](N)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C16H27NO/c1-11(2)5-10-15(18)16(17)14-8-6-13(7-9-14)12(3)4/h6-9,11-12,15-16,18H,5,10,17H2,1-4H3/t15-,16+/m0/s1 |
| InChIKey | DQDMALIOGMZZNQ-JKSUJKDBSA-N |
| XLogP | 3.61 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |