C13H22ClNO — CID 171162399
(1S,2R)-1-amino-1-(4-propan-2-ylphenyl)butan-2-ol;hydrochloride (PubChem CID 171162399) has the molecular formula C13H22ClNO and a molecular weight of 243.78 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(4-propan-2-ylphenyl)butan-2-ol;hydrochloride.
| Compound Name | (1S,2R)-1-amino-1-(4-propan-2-ylphenyl)butan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171162399 |
| Molecular Formula | C13H22ClNO |
| Molecular Weight | 243.78 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | (1S,2R)-1-amino-1-(4-propan-2-ylphenyl)butan-2-ol;hydrochloride |
| SMILES | CC[C@@H](O)[C@@H](N)c1ccc(C(C)C)cc1.Cl |
| InChI | InChI=1S/C13H21NO.ClH/c1-4-12(15)13(14)11-7-5-10(6-8-11)9(2)3;/h5-9,12-13,15H,4,14H2,1-3H3;1H/t12-,13+;/m1./s1 |
| InChIKey | WIFALUPNUIPQBG-KZCZEQIWSA-N |
| XLogP | 3.00 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.78 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |