C14H23NO — CID 171160973
(1R,2S)-1-amino-3-methyl-1-(4-propan-2-ylphenyl)butan-2-ol (PubChem CID 171160973) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is (1R,2S)-1-amino-3-methyl-1-(4-propan-2-ylphenyl)butan-2-ol.
| Compound Name | (1R,2S)-1-amino-3-methyl-1-(4-propan-2-ylphenyl)butan-2-ol |
|---|---|
| PubChem CID | 171160973 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (1R,2S)-1-amino-3-methyl-1-(4-propan-2-ylphenyl)butan-2-ol |
| SMILES | CC(C)c1ccc([C@@H](N)[C@@H](O)C(C)C)cc1 |
| InChI | InChI=1S/C14H23NO/c1-9(2)11-5-7-12(8-6-11)13(15)14(16)10(3)4/h5-10,13-14,16H,15H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | QTMFOCRXZFUTGL-KGLIPLIRSA-N |
| XLogP | 2.83 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |