C11H13ClF3NO — CID 171271375
(1S,2R)-1-amino-1-[3-chloro-4-(trifluoromethyl)phenyl]butan-2-ol (PubChem CID 171271375) has the molecular formula C11H13ClF3NO and a molecular weight of 267.68 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-[3-chloro-4-(trifluoromethyl)phenyl]butan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-[3-chloro-4-(trifluoromethyl)phenyl]butan-2-ol |
|---|---|
| PubChem CID | 171271375 |
| Molecular Formula | C11H13ClF3NO |
| Molecular Weight | 267.68 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | (1S,2R)-1-amino-1-[3-chloro-4-(trifluoromethyl)phenyl]butan-2-ol |
| SMILES | CC[C@@H](O)[C@@H](N)c1ccc(C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C11H13ClF3NO/c1-2-9(17)10(16)6-3-4-7(8(12)5-6)11(13,14)15/h3-5,9-10,17H,2,16H2,1H3/t9-,10+/m1/s1 |
| InChIKey | HBZNXBIKPUWEBO-ZJUUUORDSA-N |
| XLogP | 3.13 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.68 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |