C9H9Cl2F4N — CID 171234863
(1R)-1-[3-chloro-4-(trifluoromethyl)phenyl]-2-fluoroethanamine;hydrochloride (PubChem CID 171234863) has the molecular formula C9H9Cl2F4N and a molecular weight of 278.08 g/mol. Its IUPAC name is (1R)-1-[3-chloro-4-(trifluoromethyl)phenyl]-2-fluoroethanamine;hydrochloride.
| Compound Name | (1R)-1-[3-chloro-4-(trifluoromethyl)phenyl]-2-fluoroethanamine;hydrochloride |
|---|---|
| PubChem CID | 171234863 |
| Molecular Formula | C9H9Cl2F4N |
| Molecular Weight | 278.08 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | (1R)-1-[3-chloro-4-(trifluoromethyl)phenyl]-2-fluoroethanamine;hydrochloride |
| SMILES | Cl.N[C@@H](CF)c1ccc(C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C9H8ClF4N.ClH/c10-7-3-5(8(15)4-11)1-2-6(7)9(12,13)14;/h1-3,8H,4,15H2;1H/t8-;/m0./s1 |
| InChIKey | ZVBTWLSCOHXCLH-QRPNPIFTSA-N |
| XLogP | 3.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.08 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |