C14H12Cl2F3N — CID 138986692
[3-chloro-4-(trifluoromethyl)phenyl]-phenylmethanamine;hydrochloride (PubChem CID 138986692) has the molecular formula C14H12Cl2F3N and a molecular weight of 322.16 g/mol. Its IUPAC name is [3-chloro-4-(trifluoromethyl)phenyl]-phenylmethanamine;hydrochloride.
| Compound Name | [3-chloro-4-(trifluoromethyl)phenyl]-phenylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 138986692 |
| Molecular Formula | C14H12Cl2F3N |
| Molecular Weight | 322.16 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | [3-chloro-4-(trifluoromethyl)phenyl]-phenylmethanamine;hydrochloride |
| SMILES | Cl.NC(c1ccccc1)c1ccc(C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C14H11ClF3N.ClH/c15-12-8-10(6-7-11(12)14(16,17)18)13(19)9-4-2-1-3-5-9;/h1-8,13H,19H2;1H |
| InChIKey | CUPRHTRSHFDNHD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.16 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |