C14H11Cl2F4N — CID 170898786
(S)-(4-chlorophenyl)-[3-fluoro-4-(trifluoromethyl)phenyl]methanamine;hydrochloride (PubChem CID 170898786) has the molecular formula C14H11Cl2F4N and a molecular weight of 340.15 g/mol. Its IUPAC name is (S)-(4-chlorophenyl)-[3-fluoro-4-(trifluoromethyl)phenyl]methanamine;hydrochloride.
| Compound Name | (S)-(4-chlorophenyl)-[3-fluoro-4-(trifluoromethyl)phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 170898786 |
| Molecular Formula | C14H11Cl2F4N |
| Molecular Weight | 340.15 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | (S)-(4-chlorophenyl)-[3-fluoro-4-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccc(Cl)cc1)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C14H10ClF4N.ClH/c15-10-4-1-8(2-5-10)13(20)9-3-6-11(12(16)7-9)14(17,18)19;/h1-7,13H,20H2;1H/t13-;/m0./s1 |
| InChIKey | BAADQVNXYGTALD-ZOWNYOTGSA-N |
| XLogP | 4.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.15 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |