C14H9ClF5N — CID 107291671
(2-chloro-6-fluorophenyl)-[3-fluoro-4-(trifluoromethyl)phenyl]methanamine (PubChem CID 107291671) has the molecular formula C14H9ClF5N and a molecular weight of 321.68 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)-[3-fluoro-4-(trifluoromethyl)phenyl]methanamine.
| Compound Name | (2-chloro-6-fluorophenyl)-[3-fluoro-4-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 107291671 |
| Molecular Formula | C14H9ClF5N |
| Molecular Weight | 321.68 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | (2-chloro-6-fluorophenyl)-[3-fluoro-4-(trifluoromethyl)phenyl]methanamine |
| SMILES | NC(c1ccc(C(F)(F)F)c(F)c1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C14H9ClF5N/c15-9-2-1-3-10(16)12(9)13(21)7-4-5-8(11(17)6-7)14(18,19)20/h1-6,13H,21H2 |
| InChIKey | QQIUMNQSWSKQMV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.68 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |