C13H9ClF4N2 — CID 102710002
(2-chloro-6-fluorophenyl)-[4-(trifluoromethyl)-3-pyridinyl]methanamine (PubChem CID 102710002) has the molecular formula C13H9ClF4N2 and a molecular weight of 304.67 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)-[4-(trifluoromethyl)-3-pyridinyl]methanamine.
| Compound Name | (2-chloro-6-fluorophenyl)-[4-(trifluoromethyl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 102710002 |
| Molecular Formula | C13H9ClF4N2 |
| Molecular Weight | 304.67 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | (2-chloro-6-fluorophenyl)-[4-(trifluoromethyl)-3-pyridinyl]methanamine |
| SMILES | NC(c1cnccc1C(F)(F)F)c1c(F)cccc1Cl |
| InChI | InChI=1S/C13H9ClF4N2/c14-9-2-1-3-10(15)11(9)12(19)7-6-20-5-4-8(7)13(16,17)18/h1-6,12H,19H2 |
| InChIKey | KBZWBBYZOYLQGD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.67 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |