C13H10ClF3N2 — CID 102708099
(2-chlorophenyl)-[4-(trifluoromethyl)-3-pyridinyl]methanamine (PubChem CID 102708099) has the molecular formula C13H10ClF3N2 and a molecular weight of 286.68 g/mol. Its IUPAC name is (2-chlorophenyl)-[4-(trifluoromethyl)-3-pyridinyl]methanamine.
| Compound Name | (2-chlorophenyl)-[4-(trifluoromethyl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 102708099 |
| Molecular Formula | C13H10ClF3N2 |
| Molecular Weight | 286.68 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | (2-chlorophenyl)-[4-(trifluoromethyl)-3-pyridinyl]methanamine |
| SMILES | NC(c1ccccc1Cl)c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C13H10ClF3N2/c14-11-4-2-1-3-8(11)12(18)9-7-19-6-5-10(9)13(15,16)17/h1-7,12H,18H2 |
| InChIKey | PJCVQKOGQZYHTP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.68 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |