C10H10ClF3O3 — CID 170818368
1-[3-chloro-4-(trifluoromethyl)phenyl]propane-1,2,3-triol (PubChem CID 170818368) has the molecular formula C10H10ClF3O3 and a molecular weight of 270.63 g/mol. Its IUPAC name is 1-[3-chloro-4-(trifluoromethyl)phenyl]propane-1,2,3-triol.
| Compound Name | 1-[3-chloro-4-(trifluoromethyl)phenyl]propane-1,2,3-triol |
|---|---|
| PubChem CID | 170818368 |
| Molecular Formula | C10H10ClF3O3 |
| Molecular Weight | 270.63 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 1-[3-chloro-4-(trifluoromethyl)phenyl]propane-1,2,3-triol |
| SMILES | OCC(O)C(O)c1ccc(C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C10H10ClF3O3/c11-7-3-5(9(17)8(16)4-15)1-2-6(7)10(12,13)14/h1-3,8-9,15-17H,4H2 |
| InChIKey | AMKQEXMOGSZSDZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.63 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |