C10H9Cl2F3O3 — CID 170818684
1-[2,6-dichloro-4-(trifluoromethyl)phenyl]propane-1,2,3-triol (PubChem CID 170818684) has the molecular formula C10H9Cl2F3O3 and a molecular weight of 305.08 g/mol. Its IUPAC name is 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]propane-1,2,3-triol.
| Compound Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]propane-1,2,3-triol |
|---|---|
| PubChem CID | 170818684 |
| Molecular Formula | C10H9Cl2F3O3 |
| Molecular Weight | 305.08 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]propane-1,2,3-triol |
| SMILES | OCC(O)C(O)c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H9Cl2F3O3/c11-5-1-4(10(13,14)15)2-6(12)8(5)9(18)7(17)3-16/h1-2,7,9,16-18H,3H2 |
| InChIKey | JRCAKTHISVNJBQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.08 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |