About 1-[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]propane-1,2,3-triol
1-[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]propane-1,2,3-triol (PubChem CID 170819193) has the molecular formula C8H10ClF3N2O3
and a molecular weight of 274.63 g/mol. Its IUPAC name is 1-[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]propane-1,2,3-triol.
Molecular Properties
| Compound Name | 1-[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]propane-1,2,3-triol |
| PubChem CID | 170819193 |
| Molecular Formula | C8H10ClF3N2O3 |
| Molecular Weight | 274.63 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 1-[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]propane-1,2,3-triol |
| SMILES | Cn1nc(C(F)(F)F)c(C(O)C(O)CO)c1Cl |
| InChI | InChI=1S/C8H10ClF3N2O3/c1-14-7(9)4(5(17)3(16)2-15)6(13-14)8(10,11)12/h3,5,15-17H,2H2,1H3 |
| InChIKey | OBQXDBAIFHAYAQ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.63 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]propane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]propane-1,2,3-triol?
The IUPAC name of 1-[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]propane-1,2,3-triol (CID 170819193) is 1-[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]propane-1,2,3-triol.
What is the SMILES notation for 1-[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]propane-1,2,3-triol?
The canonical SMILES for 1-[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]propane-1,2,3-triol is Cn1nc(C(F)(F)F)c(C(O)C(O)CO)c1Cl.
What is the InChIKey of 1-[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]propane-1,2,3-triol?
The InChIKey is OBQXDBAIFHAYAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClF3N2O3/c1-14-7(9)4(5(17)3(16)2-15)6(13-14)8(10,11)12/h3,5,15-17H,2H2,1H3.
What are the key properties of 1-[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]propane-1,2,3-triol?
1-[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]propane-1,2,3-triol has a molecular weight of 274.63 g/mol, XLogP of 0.48, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]propane-1,2,3-triol is sourced from PubChem (CID 170819193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).