C10H18ClF3N2 — CID 143994582
5-chloro-1,4-dimethyl-3-(trifluoromethyl)pyrazole;ethane (PubChem CID 143994582) has the molecular formula C10H18ClF3N2 and a molecular weight of 258.71 g/mol. Its IUPAC name is 5-chloro-1,4-dimethyl-3-(trifluoromethyl)pyrazole;ethane.
| Compound Name | 5-chloro-1,4-dimethyl-3-(trifluoromethyl)pyrazole;ethane |
|---|---|
| PubChem CID | 143994582 |
| Molecular Formula | C10H18ClF3N2 |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 5-chloro-1,4-dimethyl-3-(trifluoromethyl)pyrazole;ethane |
| SMILES | CC.CC.Cc1c(C(F)(F)F)nn(C)c1Cl |
| InChI | InChI=1S/C6H6ClF3N2.2C2H6/c1-3-4(6(8,9)10)11-12(2)5(3)7;2*1-2/h1-2H3;2*1-2H3 |
| InChIKey | GLEPBKDXUADHHX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |