C8H15ClN2 — CID 143473362
5-chloro-1,3,4-trimethylpyrazole;ethane (PubChem CID 143473362) has the molecular formula C8H15ClN2 and a molecular weight of 174.67 g/mol. Its IUPAC name is 5-chloro-1,3,4-trimethylpyrazole;ethane.
| Compound Name | 5-chloro-1,3,4-trimethylpyrazole;ethane |
|---|---|
| PubChem CID | 143473362 |
| Molecular Formula | C8H15ClN2 |
| Molecular Weight | 174.67 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 5-chloro-1,3,4-trimethylpyrazole;ethane |
| SMILES | CC.Cc1nn(C)c(Cl)c1C |
| InChI | InChI=1S/C6H9ClN2.C2H6/c1-4-5(2)8-9(3)6(4)7;1-2/h1-3H3;1-2H3 |
| InChIKey | FAFRDPZLVKHEEA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.67 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |