C8H13ClN2 — CID 23005969
4-(2-chloroethyl)-1,3,5-trimethylpyrazole (PubChem CID 23005969) has the molecular formula C8H13ClN2 and a molecular weight of 172.66 g/mol. Its IUPAC name is 4-(2-chloroethyl)-1,3,5-trimethylpyrazole.
| Compound Name | 4-(2-chloroethyl)-1,3,5-trimethylpyrazole |
|---|---|
| PubChem CID | 23005969 |
| Molecular Formula | C8H13ClN2 |
| Molecular Weight | 172.66 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 4-(2-chloroethyl)-1,3,5-trimethylpyrazole |
| SMILES | Cc1nn(C)c(C)c1CCCl |
| InChI | InChI=1S/C8H13ClN2/c1-6-8(4-5-9)7(2)11(3)10-6/h4-5H2,1-3H3 |
| InChIKey | NQZGXXBRNUEZES-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.66 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|