About 4-(2-chloroethyl)-1,3,5-trimethylpyrazole
4-(2-chloroethyl)-1,3,5-trimethylpyrazole (PubChem CID 23005969) has the molecular formula C8H13ClN2
and a molecular weight of 172.66 g/mol. Its IUPAC name is 4-(2-chloroethyl)-1,3,5-trimethylpyrazole.
Molecular Properties
| Compound Name | 4-(2-chloroethyl)-1,3,5-trimethylpyrazole |
| PubChem CID | 23005969 |
| Molecular Formula | C8H13ClN2 |
| Molecular Weight | 172.66 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 4-(2-chloroethyl)-1,3,5-trimethylpyrazole |
| SMILES | Cc1nn(C)c(C)c1CCCl |
| InChI | InChI=1S/C8H13ClN2/c1-6-8(4-5-9)7(2)11(3)10-6/h4-5H2,1-3H3 |
| InChIKey | NQZGXXBRNUEZES-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.66 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-chloroethyl)-1,3,5-trimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloroethyl)-1,3,5-trimethylpyrazole?
The IUPAC name of 4-(2-chloroethyl)-1,3,5-trimethylpyrazole (CID 23005969) is 4-(2-chloroethyl)-1,3,5-trimethylpyrazole.
What is the SMILES notation for 4-(2-chloroethyl)-1,3,5-trimethylpyrazole?
The canonical SMILES for 4-(2-chloroethyl)-1,3,5-trimethylpyrazole is Cc1nn(C)c(C)c1CCCl.
What is the InChIKey of 4-(2-chloroethyl)-1,3,5-trimethylpyrazole?
The InChIKey is NQZGXXBRNUEZES-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClN2/c1-6-8(4-5-9)7(2)11(3)10-6/h4-5H2,1-3H3.
What are the key properties of 4-(2-chloroethyl)-1,3,5-trimethylpyrazole?
4-(2-chloroethyl)-1,3,5-trimethylpyrazole has a molecular weight of 172.66 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloroethyl)-1,3,5-trimethylpyrazole is sourced from PubChem (CID 23005969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).