About 1-(4-chloro-1-methylpyrazol-3-yl)propane-1,2,3-triol
1-(4-chloro-1-methylpyrazol-3-yl)propane-1,2,3-triol (PubChem CID 170819237) has the molecular formula C7H11ClN2O3
and a molecular weight of 206.63 g/mol. Its IUPAC name is 1-(4-chloro-1-methylpyrazol-3-yl)propane-1,2,3-triol.
Molecular Properties
| Compound Name | 1-(4-chloro-1-methylpyrazol-3-yl)propane-1,2,3-triol |
| PubChem CID | 170819237 |
| Molecular Formula | C7H11ClN2O3 |
| Molecular Weight | 206.63 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 1-(4-chloro-1-methylpyrazol-3-yl)propane-1,2,3-triol |
| SMILES | Cn1cc(Cl)c(C(O)C(O)CO)n1 |
| InChI | InChI=1S/C7H11ClN2O3/c1-10-2-4(8)6(9-10)7(13)5(12)3-11/h2,5,7,11-13H,3H2,1H3 |
| InChIKey | STINUOPRHRYCSS-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.63 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-chloro-1-methylpyrazol-3-yl)propane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-1-methylpyrazol-3-yl)propane-1,2,3-triol?
The IUPAC name of 1-(4-chloro-1-methylpyrazol-3-yl)propane-1,2,3-triol (CID 170819237) is 1-(4-chloro-1-methylpyrazol-3-yl)propane-1,2,3-triol.
What is the SMILES notation for 1-(4-chloro-1-methylpyrazol-3-yl)propane-1,2,3-triol?
The canonical SMILES for 1-(4-chloro-1-methylpyrazol-3-yl)propane-1,2,3-triol is Cn1cc(Cl)c(C(O)C(O)CO)n1.
What is the InChIKey of 1-(4-chloro-1-methylpyrazol-3-yl)propane-1,2,3-triol?
The InChIKey is STINUOPRHRYCSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClN2O3/c1-10-2-4(8)6(9-10)7(13)5(12)3-11/h2,5,7,11-13H,3H2,1H3.
What are the key properties of 1-(4-chloro-1-methylpyrazol-3-yl)propane-1,2,3-triol?
1-(4-chloro-1-methylpyrazol-3-yl)propane-1,2,3-triol has a molecular weight of 206.63 g/mol, XLogP of -0.54, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-1-methylpyrazol-3-yl)propane-1,2,3-triol is sourced from PubChem (CID 170819237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).