C13H20BClN2O4 — CID 170816053
3-(4-chloro-1-methylpyrazol-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid (PubChem CID 170816053) has the molecular formula C13H20BClN2O4 and a molecular weight of 314.58 g/mol. Its IUPAC name is 3-(4-chloro-1-methylpyrazol-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid.
| Compound Name | 3-(4-chloro-1-methylpyrazol-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 170816053 |
| Molecular Formula | C13H20BClN2O4 |
| Molecular Weight | 314.58 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 3-(4-chloro-1-methylpyrazol-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
| SMILES | Cn1cc(Cl)c(C(CC(=O)O)B2OC(C)(C)C(C)(C)O2)n1 |
| InChI | InChI=1S/C13H20BClN2O4/c1-12(2)13(3,4)21-14(20-12)8(6-10(18)19)11-9(15)7-17(5)16-11/h7-8H,6H2,1-5H3,(H,18,19) |
| InChIKey | XHACDOAZIRZFOB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.58 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|