C15H20BClO5 — CID 170815823
3-(2-chloro-3-hydroxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid (PubChem CID 170815823) has the molecular formula C15H20BClO5 and a molecular weight of 326.59 g/mol. Its IUPAC name is 3-(2-chloro-3-hydroxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid.
| Compound Name | 3-(2-chloro-3-hydroxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 170815823 |
| Molecular Formula | C15H20BClO5 |
| Molecular Weight | 326.59 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 3-(2-chloro-3-hydroxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
| SMILES | CC1(C)OB(C(CC(=O)O)c2cccc(O)c2Cl)OC1(C)C |
| InChI | InChI=1S/C15H20BClO5/c1-14(2)15(3,4)22-16(21-14)10(8-12(19)20)9-6-5-7-11(18)13(9)17/h5-7,10,18H,8H2,1-4H3,(H,19,20) |
| InChIKey | YATACVMWKUOIMH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|