C19H28BNO4 — CID 170815668
3-(2-pyrrolidin-1-ylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid (PubChem CID 170815668) has the molecular formula C19H28BNO4 and a molecular weight of 345.25 g/mol. Its IUPAC name is 3-(2-pyrrolidin-1-ylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid.
| Compound Name | 3-(2-pyrrolidin-1-ylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 170815668 |
| Molecular Formula | C19H28BNO4 |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 3-(2-pyrrolidin-1-ylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
| SMILES | CC1(C)OB(C(CC(=O)O)c2ccccc2N2CCCC2)OC1(C)C |
| InChI | InChI=1S/C19H28BNO4/c1-18(2)19(3,4)25-20(24-18)15(13-17(22)23)14-9-5-6-10-16(14)21-11-7-8-12-21/h5-6,9-10,15H,7-8,11-13H2,1-4H3,(H,22,23) |
| InChIKey | MYIUQOUKEXFQEZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|