C17H21BO4 — CID 170815807
3-(2-ethynylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid (PubChem CID 170815807) has the molecular formula C17H21BO4 and a molecular weight of 300.16 g/mol. Its IUPAC name is 3-(2-ethynylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid.
| Compound Name | 3-(2-ethynylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 170815807 |
| Molecular Formula | C17H21BO4 |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 3-(2-ethynylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
| SMILES | C#Cc1ccccc1C(CC(=O)O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H21BO4/c1-6-12-9-7-8-10-13(12)14(11-15(19)20)18-21-16(2,3)17(4,5)22-18/h1,7-10,14H,11H2,2-5H3,(H,19,20) |
| InChIKey | JDDKGPQABUDJQU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|