C15H23BO4S — CID 170816037
3-(2,5-dimethylthiophen-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid (PubChem CID 170816037) has the molecular formula C15H23BO4S and a molecular weight of 310.22 g/mol. Its IUPAC name is 3-(2,5-dimethylthiophen-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid.
| Compound Name | 3-(2,5-dimethylthiophen-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 170816037 |
| Molecular Formula | C15H23BO4S |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3-(2,5-dimethylthiophen-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
| SMILES | Cc1cc(C(CC(=O)O)B2OC(C)(C)C(C)(C)O2)c(C)s1 |
| InChI | InChI=1S/C15H23BO4S/c1-9-7-11(10(2)21-9)12(8-13(17)18)16-19-14(3,4)15(5,6)20-16/h7,12H,8H2,1-6H3,(H,17,18) |
| InChIKey | CJPRKUUDRMFUNE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|