C14H21BO4S — CID 170815942
3-(5-methylthiophen-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid (PubChem CID 170815942) has the molecular formula C14H21BO4S and a molecular weight of 296.20 g/mol. Its IUPAC name is 3-(5-methylthiophen-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid.
| Compound Name | 3-(5-methylthiophen-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 170815942 |
| Molecular Formula | C14H21BO4S |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-(5-methylthiophen-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
| SMILES | Cc1ccc(C(CC(=O)O)B2OC(C)(C)C(C)(C)O2)s1 |
| InChI | InChI=1S/C14H21BO4S/c1-9-6-7-11(20-9)10(8-12(16)17)15-18-13(2,3)14(4,5)19-15/h6-7,10H,8H2,1-5H3,(H,16,17) |
| InChIKey | YWEIODDKLYPUSO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|