C16H20BF3O4 — CID 170815876
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[4-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 170815876) has the molecular formula C16H20BF3O4 and a molecular weight of 344.14 g/mol. Its IUPAC name is 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[4-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[4-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 170815876 |
| Molecular Formula | C16H20BF3O4 |
| Molecular Weight | 344.14 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[4-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | CC1(C)OB(C(CC(=O)O)c2ccc(C(F)(F)F)cc2)OC1(C)C |
| InChI | InChI=1S/C16H20BF3O4/c1-14(2)15(3,4)24-17(23-14)12(9-13(21)22)10-5-7-11(8-6-10)16(18,19)20/h5-8,12H,9H2,1-4H3,(H,21,22) |
| InChIKey | VYHNEIUVKNYMLO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.14 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|