C21H25BO4 — CID 170815702
3-(2-phenylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid (PubChem CID 170815702) has the molecular formula C21H25BO4 and a molecular weight of 352.24 g/mol. Its IUPAC name is 3-(2-phenylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid.
| Compound Name | 3-(2-phenylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 170815702 |
| Molecular Formula | C21H25BO4 |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 3-(2-phenylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
| SMILES | CC1(C)OB(C(CC(=O)O)c2ccccc2-c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C21H25BO4/c1-20(2)21(3,4)26-22(25-20)18(14-19(23)24)17-13-9-8-12-16(17)15-10-6-5-7-11-15/h5-13,18H,14H2,1-4H3,(H,23,24) |
| InChIKey | MOBYEVHKYCQUBE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|