C17H21BO4S — CID 170816036
3-(1-benzothiophen-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid (PubChem CID 170816036) has the molecular formula C17H21BO4S and a molecular weight of 332.23 g/mol. Its IUPAC name is 3-(1-benzothiophen-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid.
| Compound Name | 3-(1-benzothiophen-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 170816036 |
| Molecular Formula | C17H21BO4S |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3-(1-benzothiophen-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
| SMILES | CC1(C)OB(C(CC(=O)O)c2csc3ccccc23)OC1(C)C |
| InChI | InChI=1S/C17H21BO4S/c1-16(2)17(3,4)22-18(21-16)13(9-15(19)20)12-10-23-14-8-6-5-7-11(12)14/h5-8,10,13H,9H2,1-4H3,(H,19,20) |
| InChIKey | JNEUAGWYKWSLLQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|