C15H19BCl2O4 — CID 170815789
3-(2,3-dichlorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid (PubChem CID 170815789) has the molecular formula C15H19BCl2O4 and a molecular weight of 345.03 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid.
| Compound Name | 3-(2,3-dichlorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 170815789 |
| Molecular Formula | C15H19BCl2O4 |
| Molecular Weight | 345.03 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
| SMILES | CC1(C)OB(C(CC(=O)O)c2cccc(Cl)c2Cl)OC1(C)C |
| InChI | InChI=1S/C15H19BCl2O4/c1-14(2)15(3,4)22-16(21-14)10(8-12(19)20)9-6-5-7-11(17)13(9)18/h5-7,10H,8H2,1-4H3,(H,19,20) |
| InChIKey | JCBQBNLNVLZRRL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.03 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|