C15H21BO6S — CID 170815930
3-(4-methoxycarbonylthiophen-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid (PubChem CID 170815930) has the molecular formula C15H21BO6S and a molecular weight of 340.21 g/mol. Its IUPAC name is 3-(4-methoxycarbonylthiophen-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid.
| Compound Name | 3-(4-methoxycarbonylthiophen-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 170815930 |
| Molecular Formula | C15H21BO6S |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 3-(4-methoxycarbonylthiophen-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
| SMILES | COC(=O)c1csc(C(CC(=O)O)B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C15H21BO6S/c1-14(2)15(3,4)22-16(21-14)10(7-12(17)18)11-6-9(8-23-11)13(19)20-5/h6,8,10H,7H2,1-5H3,(H,17,18) |
| InChIKey | OVZFJEWAYOSQKJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|