C13H16BCl3N2O4 — CID 170816074
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,6-trichloropyrimidin-5-yl)propanoic acid (PubChem CID 170816074) has the molecular formula C13H16BCl3N2O4 and a molecular weight of 381.45 g/mol. Its IUPAC name is 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,6-trichloropyrimidin-5-yl)propanoic acid.
| Compound Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,6-trichloropyrimidin-5-yl)propanoic acid |
|---|---|
| PubChem CID | 170816074 |
| Molecular Formula | C13H16BCl3N2O4 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,6-trichloropyrimidin-5-yl)propanoic acid |
| SMILES | CC1(C)OB(C(CC(=O)O)c2c(Cl)nc(Cl)nc2Cl)OC1(C)C |
| InChI | InChI=1S/C13H16BCl3N2O4/c1-12(2)13(3,4)23-14(22-12)6(5-7(20)21)8-9(15)18-11(17)19-10(8)16/h6H,5H2,1-4H3,(H,20,21) |
| InChIKey | UOOYDQYQIAHOND-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|