C14H20BClO4S — CID 170816546
methyl 3-(5-chlorothiophen-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 170816546) has the molecular formula C14H20BClO4S and a molecular weight of 330.64 g/mol. Its IUPAC name is methyl 3-(5-chlorothiophen-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | methyl 3-(5-chlorothiophen-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 170816546 |
| Molecular Formula | C14H20BClO4S |
| Molecular Weight | 330.64 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | methyl 3-(5-chlorothiophen-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | COC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H20BClO4S/c1-13(2)14(3,4)20-15(19-13)9(8-12(17)18-5)10-6-7-11(16)21-10/h6-7,9H,8H2,1-5H3 |
| InChIKey | RNCHBGRIZLAXSQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.64 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|