C13H21BN2O4 — CID 170816003
3-(5-methyl-1H-pyrazol-4-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid (PubChem CID 170816003) has the molecular formula C13H21BN2O4 and a molecular weight of 280.13 g/mol. Its IUPAC name is 3-(5-methyl-1H-pyrazol-4-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid.
| Compound Name | 3-(5-methyl-1H-pyrazol-4-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 170816003 |
| Molecular Formula | C13H21BN2O4 |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 3-(5-methyl-1H-pyrazol-4-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
| SMILES | Cc1[nH]ncc1C(CC(=O)O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H21BN2O4/c1-8-9(7-15-16-8)10(6-11(17)18)14-19-12(2,3)13(4,5)20-14/h7,10H,6H2,1-5H3,(H,15,16)(H,17,18) |
| InChIKey | WPACABHMGXYSFE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|