C7H11ClN2O2S — CID 170821293
1-(4-chloro-1-methylpyrazol-3-yl)-3-sulfanylpropane-1,2-diol (PubChem CID 170821293) has the molecular formula C7H11ClN2O2S and a molecular weight of 222.70 g/mol. Its IUPAC name is 1-(4-chloro-1-methylpyrazol-3-yl)-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-(4-chloro-1-methylpyrazol-3-yl)-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170821293 |
| Molecular Formula | C7H11ClN2O2S |
| Molecular Weight | 222.70 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | 1-(4-chloro-1-methylpyrazol-3-yl)-3-sulfanylpropane-1,2-diol |
| SMILES | Cn1cc(Cl)c(C(O)C(O)CS)n1 |
| InChI | InChI=1S/C7H11ClN2O2S/c1-10-2-4(8)6(9-10)7(12)5(11)3-13/h2,5,7,11-13H,3H2,1H3 |
| InChIKey | TZDMKZGCTWPHAL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.70 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|